C10H20N2O2S — CID 106996411
2-(2-methylpiperidin-4-yl)thiazinane 1,1-dioxide (PubChem CID 106996411) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-(2-methylpiperidin-4-yl)thiazinane 1,1-dioxide.
| Compound Name | 2-(2-methylpiperidin-4-yl)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 106996411 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-(2-methylpiperidin-4-yl)thiazinane 1,1-dioxide |
| SMILES | CC1CC(N2CCCCS2(=O)=O)CCN1 |
| InChI | InChI=1S/C10H20N2O2S/c1-9-8-10(4-5-11-9)12-6-2-3-7-15(12,13)14/h9-11H,2-8H2,1H3 |
| InChIKey | ZYXPYQHOJMFGDU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |