C11H5BrF5N3O — CID 106999041
5-bromo-4-methoxy-N-(2,3,4,5,6-pentafluorophenyl)pyrimidin-2-amine (PubChem CID 106999041) has the molecular formula C11H5BrF5N3O and a molecular weight of 370.08 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N-(2,3,4,5,6-pentafluorophenyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-methoxy-N-(2,3,4,5,6-pentafluorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106999041 |
| Molecular Formula | C11H5BrF5N3O |
| Molecular Weight | 370.08 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | 5-bromo-4-methoxy-N-(2,3,4,5,6-pentafluorophenyl)pyrimidin-2-amine |
| SMILES | COc1nc(Nc2c(F)c(F)c(F)c(F)c2F)ncc1Br |
| InChI | InChI=1S/C11H5BrF5N3O/c1-21-10-3(12)2-18-11(20-10)19-9-7(16)5(14)4(13)6(15)8(9)17/h2H,1H3,(H,18,19,20) |
| InChIKey | WYFANWBEHUGYQR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.08 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|