C15H6F17N3O4S3 — CID 10699991
6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)-1,3-benzothiazole-2-sulfonamide (PubChem CID 10699991) has the molecular formula C15H6F17N3O4S3 and a molecular weight of 711.40 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)-1,3-benzothiazole-2-sulfonamide.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)-1,3-benzothiazole-2-sulfonamide |
|---|---|
| PubChem CID | 10699991 |
| Molecular Formula | C15H6F17N3O4S3 |
| Molecular Weight | 711.40 g/mol |
| Exact Mass | 710.92 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)-1,3-benzothiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc2ccc(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C15H6F17N3O4S3/c16-8(17,10(20,21)12(24,25)14(28,29)30)9(18,19)11(22,23)13(26,27)15(31,32)42(38,39)35-4-1-2-5-6(3-4)40-7(34-5)41(33,36)37/h1-3,35H,(H2,33,36,37) |
| InChIKey | QVXLLSDFMNQMLD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|