C42H32FN3O6S — CID 10700085
4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-[[(2S,4R)-1-[2-(4-fluorobenzoyl)benzoyl]-4-(2-phenylphenoxy)pyrrolidin-2-yl]methyl]benzamide (PubChem CID 10700085) has the molecular formula C42H32FN3O6S and a molecular weight of 725.80 g/mol. Its IUPAC name is 4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-[[(2S,4R)-1-[2-(4-fluorobenzoyl)benzoyl]-4-(2-phenylphenoxy)pyrrolidin-2-yl]methyl]benzamide.
| Compound Name | 4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-[[(2S,4R)-1-[2-(4-fluorobenzoyl)benzoyl]-4-(2-phenylphenoxy)pyrrolidin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 10700085 |
| Molecular Formula | C42H32FN3O6S |
| Molecular Weight | 725.80 g/mol |
| Exact Mass | 725.20 |
| IUPAC Name | 4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-[[(2S,4R)-1-[2-(4-fluorobenzoyl)benzoyl]-4-(2-phenylphenoxy)pyrrolidin-2-yl]methyl]benzamide |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(C(=O)NC[C@@H]3C[C@@H](Oc4ccccc4-c4ccccc4)CN3C(=O)c3ccccc3C(=O)c3ccc(F)cc3)cc2)S1 |
| InChI | InChI=1S/C42H32FN3O6S/c43-30-20-18-28(19-21-30)38(47)34-11-4-5-12-35(34)41(50)46-25-32(52-36-13-7-6-10-33(36)27-8-2-1-3-9-27)23-31(46)24-44-39(48)29-16-14-26(15-17-29)22-37-40(49)45-42(51)53-37/h1-22,31-32H,23-25H2,(H,44,48)(H,45,49,51)/b37-22-/t31-,32+/m0/s1 |
| InChIKey | RTQPUJJWJXJJNN-HPUMGSKDSA-N |
| XLogP | 7.14 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.80 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|