C7H10N2OS — CID 107002027
5-(2,2-dimethylcyclopropyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 107002027) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 5-(2,2-dimethylcyclopropyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2,2-dimethylcyclopropyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 107002027 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 5-(2,2-dimethylcyclopropyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CC1(C)CC1c1n[nH]c(=S)o1 |
| InChI | InChI=1S/C7H10N2OS/c1-7(2)3-4(7)5-8-9-6(11)10-5/h4H,3H2,1-2H3,(H,9,11) |
| InChIKey | HQDHLOMZIITHFK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|