C11H19N3S — CID 107002080
4-tert-butyl-3-(2,2-dimethylcyclopropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 107002080) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 4-tert-butyl-3-(2,2-dimethylcyclopropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-tert-butyl-3-(2,2-dimethylcyclopropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 107002080 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 4-tert-butyl-3-(2,2-dimethylcyclopropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC1(C)CC1c1n[nH]c(=S)n1C(C)(C)C |
| InChI | InChI=1S/C11H19N3S/c1-10(2,3)14-8(12-13-9(14)15)7-6-11(7,4)5/h7H,6H2,1-5H3,(H,13,15) |
| InChIKey | PDCJBKYFFCVONA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|