About 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole
2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole (PubChem CID 107003163) has the molecular formula C7H9BrN2S
and a molecular weight of 233.13 g/mol. Its IUPAC name is 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole.
Analyze 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole?
The IUPAC name of 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole (CID 107003163) is 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole?
The canonical SMILES for 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole is CC1(C)CC1c1nnc(Br)s1.
What is the InChIKey of 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole?
The InChIKey is LZMBQLSLWYXPSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2S/c1-7(2)3-4(7)5-9-10-6(8)11-5/h4H,3H2,1-2H3.
What are the key properties of 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole?
2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole has a molecular weight of 233.13 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(2,2-dimethylcyclopropyl)-1,3,4-thiadiazole is sourced from PubChem (CID 107003163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).