C11H18ClNO — CID 107003299
N-[[1-(chloromethyl)cyclopropyl]methyl]-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 107003299) has the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopropyl]methyl]-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 107003299 |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)CC1C(=O)NCC1(CCl)CC1 |
| InChI | InChI=1S/C11H18ClNO/c1-10(2)5-8(10)9(14)13-7-11(6-12)3-4-11/h8H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | XDYXIYVNGMDVOB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.72 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|