About 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid
2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid (PubChem CID 107003583) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid |
| PubChem CID | 107003583 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid |
| SMILES | CCCc1nc(C2CC2(C)C)oc1C(=O)O |
| InChI | InChI=1S/C12H17NO3/c1-4-5-8-9(11(14)15)16-10(13-8)7-6-12(7,2)3/h7H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | WYDASMUVNIFIDS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid (CID 107003583) is 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid is CCCc1nc(C2CC2(C)C)oc1C(=O)O.
What is the InChIKey of 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid?
The InChIKey is WYDASMUVNIFIDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-4-5-8-9(11(14)15)16-10(13-8)7-6-12(7,2)3/h7H,4-6H2,1-3H3,(H,14,15).
What are the key properties of 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid?
2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid has a molecular weight of 223.27 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylcyclopropyl)-4-propyl-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 107003583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).