C14H24O — CID 107005521
cycloocten-1-yl-(2,2-dimethylcyclopropyl)methanol (PubChem CID 107005521) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is cycloocten-1-yl-(2,2-dimethylcyclopropyl)methanol.
| Compound Name | cycloocten-1-yl-(2,2-dimethylcyclopropyl)methanol |
|---|---|
| PubChem CID | 107005521 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | cycloocten-1-yl-(2,2-dimethylcyclopropyl)methanol |
| SMILES | CC1(C)CC1C(O)C1=CCCCCCC1 |
| InChI | InChI=1S/C14H24O/c1-14(2)10-12(14)13(15)11-8-6-4-3-5-7-9-11/h8,12-13,15H,3-7,9-10H2,1-2H3 |
| InChIKey | YFYSYWUQFQMPAE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|