C16H24BrNO2 — CID 107006117
(3-bromo-5-ethoxy-4-hept-6-enoxyphenyl)methanamine (PubChem CID 107006117) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is (3-bromo-5-ethoxy-4-hept-6-enoxyphenyl)methanamine.
| Compound Name | (3-bromo-5-ethoxy-4-hept-6-enoxyphenyl)methanamine |
|---|---|
| PubChem CID | 107006117 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (3-bromo-5-ethoxy-4-hept-6-enoxyphenyl)methanamine |
| SMILES | C=CCCCCCOc1c(Br)cc(CN)cc1OCC |
| InChI | InChI=1S/C16H24BrNO2/c1-3-5-6-7-8-9-20-16-14(17)10-13(12-18)11-15(16)19-4-2/h3,10-11H,1,4-9,12,18H2,2H3 |
| InChIKey | BRSFPAKAFZYSHK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|