C30H44N8O6 — CID 10700716
(2S)-2,6-diamino-N-[2-[[4-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl]hexanamide (PubChem CID 10700716) has the molecular formula C30H44N8O6 and a molecular weight of 612.73 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-[[4-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-[[4-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl]hexanamide |
|---|---|
| PubChem CID | 10700716 |
| Molecular Formula | C30H44N8O6 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-[[4-[2-[[(2S)-2,6-diaminohexanoyl]amino]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NCCNc1ccc(NCCNC(=O)[C@@H](N)CCCCN)c2c1C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C30H44N8O6/c31-11-3-1-5-17(33)29(43)37-15-13-35-19-7-8-20(36-14-16-38-30(44)18(34)6-2-4-12-32)24-23(19)27(41)25-21(39)9-10-22(40)26(25)28(24)42/h7-10,17-18,35-36,39-40H,1-6,11-16,31-34H2,(H,37,43)(H,38,44)/t17-,18-/m0/s1 |
| InChIKey | AZRNCSVMKZABML-ROUUACIJSA-N |
| XLogP | -0.16 |
| TPSA | 260.94 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|