About 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one
7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one (PubChem CID 107007272) has the molecular formula C18H24O3
and a molecular weight of 288.39 g/mol. Its IUPAC name is 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one.
Molecular Properties
| Compound Name | 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one |
| PubChem CID | 107007272 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one |
| SMILES | C=CCCCCCOc1ccc2c(c1)OC(C)(C)CC2=O |
| InChI | InChI=1S/C18H24O3/c1-4-5-6-7-8-11-20-14-9-10-15-16(19)13-18(2,3)21-17(15)12-14/h4,9-10,12H,1,5-8,11,13H2,2-3H3 |
| InChIKey | QRBLDSQBDUXRSI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one?
The IUPAC name of 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one (CID 107007272) is 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one.
What is the SMILES notation for 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one?
The canonical SMILES for 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one is C=CCCCCCOc1ccc2c(c1)OC(C)(C)CC2=O.
What is the InChIKey of 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one?
The InChIKey is QRBLDSQBDUXRSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O3/c1-4-5-6-7-8-11-20-14-9-10-15-16(19)13-18(2,3)21-17(15)12-14/h4,9-10,12H,1,5-8,11,13H2,2-3H3.
What are the key properties of 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one?
7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one has a molecular weight of 288.39 g/mol, XLogP of 4.56, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hept-6-enoxy-2,2-dimethyl-3H-chromen-4-one is sourced from PubChem (CID 107007272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).