C54H48N4SZn — CID 10700756
zinc 5-(4-methylsulfanylphenyl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diide (PubChem CID 10700756) has the molecular formula C54H48N4SZn and a molecular weight of 850.46 g/mol. Its IUPAC name is zinc 5-(4-methylsulfanylphenyl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diide.
| Compound Name | zinc 5-(4-methylsulfanylphenyl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 10700756 |
| Molecular Formula | C54H48N4SZn |
| Molecular Weight | 850.46 g/mol |
| Exact Mass | 848.29 |
| IUPAC Name | zinc 5-(4-methylsulfanylphenyl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diide |
| SMILES | CSc1ccc(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([n-]4)c(-c4c(C)cc(C)cc4C)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C54H48N4S.Zn/c1-29-23-32(4)48(33(5)24-29)52-42-17-15-40(55-42)51(38-11-13-39(59-10)14-12-38)41-16-18-43(56-41)53(49-34(6)25-30(2)26-35(49)7)45-20-22-47(58-45)54(46-21-19-44(52)57-46)50-36(8)27-31(3)28-37(50)9;/h11-28H,1-10H3;/q-2;+2/b51-40-,51-41-,52-42+,52-44+,53-43+,53-45+,54-46+,54-47+; |
| InChIKey | NGZLYQFSJCXGRU-XRBKZUQKSA-N |
| XLogP | 14.08 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.46 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|