C12H16N2O3 — CID 107007570
1-hept-6-enyl-6-oxopyridazine-3-carboxylic acid (PubChem CID 107007570) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-hept-6-enyl-6-oxopyridazine-3-carboxylic acid.
| Compound Name | 1-hept-6-enyl-6-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 107007570 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-hept-6-enyl-6-oxopyridazine-3-carboxylic acid |
| SMILES | C=CCCCCCn1nc(C(=O)O)ccc1=O |
| InChI | InChI=1S/C12H16N2O3/c1-2-3-4-5-6-9-14-11(15)8-7-10(13-14)12(16)17/h2,7-8H,1,3-6,9H2,(H,16,17) |
| InChIKey | NFKJQXCUKMTTDH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|