C13H26N2 — CID 107008079
1-cyclopropyl-N-hept-6-enyl-N-methylethane-1,2-diamine (PubChem CID 107008079) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-cyclopropyl-N-hept-6-enyl-N-methylethane-1,2-diamine.
| Compound Name | 1-cyclopropyl-N-hept-6-enyl-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 107008079 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-cyclopropyl-N-hept-6-enyl-N-methylethane-1,2-diamine |
| SMILES | C=CCCCCCN(C)C(CN)C1CC1 |
| InChI | InChI=1S/C13H26N2/c1-3-4-5-6-7-10-15(2)13(11-14)12-8-9-12/h3,12-13H,1,4-11,14H2,2H3 |
| InChIKey | GQUWDXWTAWPUIL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|