C12H20F2O2 — CID 107008428
1-(2,2-difluoroethoxy)dec-9-en-3-one (PubChem CID 107008428) has the molecular formula C12H20F2O2 and a molecular weight of 234.29 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)dec-9-en-3-one.
| Compound Name | 1-(2,2-difluoroethoxy)dec-9-en-3-one |
|---|---|
| PubChem CID | 107008428 |
| Molecular Formula | C12H20F2O2 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(2,2-difluoroethoxy)dec-9-en-3-one |
| SMILES | C=CCCCCCC(=O)CCOCC(F)F |
| InChI | InChI=1S/C12H20F2O2/c1-2-3-4-5-6-7-11(15)8-9-16-10-12(13)14/h2,12H,1,3-10H2 |
| InChIKey | SNXDPEXFXKOJIZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|