C14H25F4NO — CID 107009843
N-ethyl-1-(2,2,3,3-tetrafluoropropoxy)non-8-en-2-amine (PubChem CID 107009843) has the molecular formula C14H25F4NO and a molecular weight of 299.35 g/mol. Its IUPAC name is N-ethyl-1-(2,2,3,3-tetrafluoropropoxy)non-8-en-2-amine.
| Compound Name | N-ethyl-1-(2,2,3,3-tetrafluoropropoxy)non-8-en-2-amine |
|---|---|
| PubChem CID | 107009843 |
| Molecular Formula | C14H25F4NO |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N-ethyl-1-(2,2,3,3-tetrafluoropropoxy)non-8-en-2-amine |
| SMILES | C=CCCCCCC(COCC(F)(F)C(F)F)NCC |
| InChI | InChI=1S/C14H25F4NO/c1-3-5-6-7-8-9-12(19-4-2)10-20-11-14(17,18)13(15)16/h3,12-13,19H,1,4-11H2,2H3 |
| InChIKey | IODXOEPQFASYFH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|