About 1-hept-6-enylimidazole-4,5-dicarbonitrile
1-hept-6-enylimidazole-4,5-dicarbonitrile (PubChem CID 107010176) has the molecular formula C12H14N4
and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-hept-6-enylimidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-hept-6-enylimidazole-4,5-dicarbonitrile |
| PubChem CID | 107010176 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-hept-6-enylimidazole-4,5-dicarbonitrile |
| SMILES | C=CCCCCCn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C12H14N4/c1-2-3-4-5-6-7-16-10-15-11(8-13)12(16)9-14/h2,10H,1,3-7H2 |
| InChIKey | APUVFVLLQNWTFE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hept-6-enylimidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hept-6-enylimidazole-4,5-dicarbonitrile?
The IUPAC name of 1-hept-6-enylimidazole-4,5-dicarbonitrile (CID 107010176) is 1-hept-6-enylimidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-hept-6-enylimidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-hept-6-enylimidazole-4,5-dicarbonitrile is C=CCCCCCn1cnc(C#N)c1C#N.
What is the InChIKey of 1-hept-6-enylimidazole-4,5-dicarbonitrile?
The InChIKey is APUVFVLLQNWTFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4/c1-2-3-4-5-6-7-16-10-15-11(8-13)12(16)9-14/h2,10H,1,3-7H2.
What are the key properties of 1-hept-6-enylimidazole-4,5-dicarbonitrile?
1-hept-6-enylimidazole-4,5-dicarbonitrile has a molecular weight of 214.27 g/mol, XLogP of 2.37, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hept-6-enylimidazole-4,5-dicarbonitrile is sourced from PubChem (CID 107010176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).