About 1-hept-6-enyl-5,6-dimethylbenzimidazole
1-hept-6-enyl-5,6-dimethylbenzimidazole (PubChem CID 107010217) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-hept-6-enyl-5,6-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-hept-6-enyl-5,6-dimethylbenzimidazole |
| PubChem CID | 107010217 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-hept-6-enyl-5,6-dimethylbenzimidazole |
| SMILES | C=CCCCCCn1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C16H22N2/c1-4-5-6-7-8-9-18-12-17-15-10-13(2)14(3)11-16(15)18/h4,10-12H,1,5-9H2,2-3H3 |
| InChIKey | KPFCKLMOGLZLAA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hept-6-enyl-5,6-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hept-6-enyl-5,6-dimethylbenzimidazole?
The IUPAC name of 1-hept-6-enyl-5,6-dimethylbenzimidazole (CID 107010217) is 1-hept-6-enyl-5,6-dimethylbenzimidazole.
What is the SMILES notation for 1-hept-6-enyl-5,6-dimethylbenzimidazole?
The canonical SMILES for 1-hept-6-enyl-5,6-dimethylbenzimidazole is C=CCCCCCn1cnc2cc(C)c(C)cc21.
What is the InChIKey of 1-hept-6-enyl-5,6-dimethylbenzimidazole?
The InChIKey is KPFCKLMOGLZLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2/c1-4-5-6-7-8-9-18-12-17-15-10-13(2)14(3)11-16(15)18/h4,10-12H,1,5-9H2,2-3H3.
What are the key properties of 1-hept-6-enyl-5,6-dimethylbenzimidazole?
1-hept-6-enyl-5,6-dimethylbenzimidazole has a molecular weight of 242.37 g/mol, XLogP of 4.40, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hept-6-enyl-5,6-dimethylbenzimidazole is sourced from PubChem (CID 107010217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).