About 1-hept-6-enyl-2,3-dihydro-1H-isoindole
1-hept-6-enyl-2,3-dihydro-1H-isoindole (PubChem CID 107010280) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-hept-6-enyl-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 1-hept-6-enyl-2,3-dihydro-1H-isoindole |
| PubChem CID | 107010280 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-hept-6-enyl-2,3-dihydro-1H-isoindole |
| SMILES | C=CCCCCCC1NCc2ccccc21 |
| InChI | InChI=1S/C15H21N/c1-2-3-4-5-6-11-15-14-10-8-7-9-13(14)12-16-15/h2,7-10,15-16H,1,3-6,11-12H2 |
| InChIKey | VJVZQICRXBSUNE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hept-6-enyl-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hept-6-enyl-2,3-dihydro-1H-isoindole?
The IUPAC name of 1-hept-6-enyl-2,3-dihydro-1H-isoindole (CID 107010280) is 1-hept-6-enyl-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 1-hept-6-enyl-2,3-dihydro-1H-isoindole?
The canonical SMILES for 1-hept-6-enyl-2,3-dihydro-1H-isoindole is C=CCCCCCC1NCc2ccccc21.
What is the InChIKey of 1-hept-6-enyl-2,3-dihydro-1H-isoindole?
The InChIKey is VJVZQICRXBSUNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N/c1-2-3-4-5-6-11-15-14-10-8-7-9-13(14)12-16-15/h2,7-10,15-16H,1,3-6,11-12H2.
What are the key properties of 1-hept-6-enyl-2,3-dihydro-1H-isoindole?
1-hept-6-enyl-2,3-dihydro-1H-isoindole has a molecular weight of 215.34 g/mol, XLogP of 3.97, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hept-6-enyl-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 107010280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).