C13H25NO — CID 107010640
(4E)-4-(methoxymethyl)undeca-4,10-dien-1-amine (PubChem CID 107010640) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (4E)-4-(methoxymethyl)undeca-4,10-dien-1-amine.
| Compound Name | (4E)-4-(methoxymethyl)undeca-4,10-dien-1-amine |
|---|---|
| PubChem CID | 107010640 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (4E)-4-(methoxymethyl)undeca-4,10-dien-1-amine |
| SMILES | C=CCCCC/C=C(\CCCN)COC |
| InChI | InChI=1S/C13H25NO/c1-3-4-5-6-7-9-13(12-15-2)10-8-11-14/h3,9H,1,4-8,10-12,14H2,2H3/b13-9+ |
| InChIKey | YAXFTKRTCBNXFH-UKTHLTGXSA-N |
| XLogP | 3.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|