About 1-(2,2,2-trifluoroethylamino)non-8-en-2-one
1-(2,2,2-trifluoroethylamino)non-8-en-2-one (PubChem CID 107010924) has the molecular formula C11H18F3NO
and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylamino)non-8-en-2-one.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethylamino)non-8-en-2-one |
| PubChem CID | 107010924 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-(2,2,2-trifluoroethylamino)non-8-en-2-one |
| SMILES | C=CCCCCCC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C11H18F3NO/c1-2-3-4-5-6-7-10(16)8-15-9-11(12,13)14/h2,15H,1,3-9H2 |
| InChIKey | IYGIEMQQWSQRFZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2,2-trifluoroethylamino)non-8-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethylamino)non-8-en-2-one?
The IUPAC name of 1-(2,2,2-trifluoroethylamino)non-8-en-2-one (CID 107010924) is 1-(2,2,2-trifluoroethylamino)non-8-en-2-one.
What is the SMILES notation for 1-(2,2,2-trifluoroethylamino)non-8-en-2-one?
The canonical SMILES for 1-(2,2,2-trifluoroethylamino)non-8-en-2-one is C=CCCCCCC(=O)CNCC(F)(F)F.
What is the InChIKey of 1-(2,2,2-trifluoroethylamino)non-8-en-2-one?
The InChIKey is IYGIEMQQWSQRFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO/c1-2-3-4-5-6-7-10(16)8-15-9-11(12,13)14/h2,15H,1,3-9H2.
What are the key properties of 1-(2,2,2-trifluoroethylamino)non-8-en-2-one?
1-(2,2,2-trifluoroethylamino)non-8-en-2-one has a molecular weight of 237.26 g/mol, XLogP of 2.84, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethylamino)non-8-en-2-one is sourced from PubChem (CID 107010924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).