About 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one
1-(1,1-dioxothiolan-3-yl)non-8-en-2-one (PubChem CID 107011237) has the molecular formula C13H22O3S
and a molecular weight of 258.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one |
| PubChem CID | 107011237 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one |
| SMILES | C=CCCCCCC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22O3S/c1-2-3-4-5-6-7-13(14)10-12-8-9-17(15,16)11-12/h2,12H,1,3-11H2 |
| InChIKey | JHZSMZVQEZEMFU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one (CID 107011237) is 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one is C=CCCCCCC(=O)CC1CCS(=O)(=O)C1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one?
The InChIKey is JHZSMZVQEZEMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3S/c1-2-3-4-5-6-7-13(14)10-12-8-9-17(15,16)11-12/h2,12H,1,3-11H2.
What are the key properties of 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one?
1-(1,1-dioxothiolan-3-yl)non-8-en-2-one has a molecular weight of 258.38 g/mol, XLogP of 2.52, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)non-8-en-2-one is sourced from PubChem (CID 107011237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).