C12H22F4N2O — CID 107012713
1-(2,2,3,3-tetrafluoropropoxy)non-8-en-2-ylhydrazine (PubChem CID 107012713) has the molecular formula C12H22F4N2O and a molecular weight of 286.31 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropoxy)non-8-en-2-ylhydrazine.
| Compound Name | 1-(2,2,3,3-tetrafluoropropoxy)non-8-en-2-ylhydrazine |
|---|---|
| PubChem CID | 107012713 |
| Molecular Formula | C12H22F4N2O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropoxy)non-8-en-2-ylhydrazine |
| SMILES | C=CCCCCCC(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C12H22F4N2O/c1-2-3-4-5-6-7-10(18-17)8-19-9-12(15,16)11(13)14/h2,10-11,18H,1,3-9,17H2 |
| InChIKey | TVAQVAPTJJEXHZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|