C13H11FN2O4 — CID 107013823
3-[(4-fluoro-2-hydroxybenzoyl)amino]-5-methyl-1H-pyrrole-2-carboxylic acid (PubChem CID 107013823) has the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 3-[(4-fluoro-2-hydroxybenzoyl)amino]-5-methyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-[(4-fluoro-2-hydroxybenzoyl)amino]-5-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 107013823 |
| Molecular Formula | C13H11FN2O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-[(4-fluoro-2-hydroxybenzoyl)amino]-5-methyl-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)c2ccc(F)cc2O)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C13H11FN2O4/c1-6-4-9(11(15-6)13(19)20)16-12(18)8-3-2-7(14)5-10(8)17/h2-5,15,17H,1H3,(H,16,18)(H,19,20) |
| InChIKey | ALPRDFTWFUITJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |