C17H17FO3 — CID 107014119
2-fluoro-6-[(2,4,6-trimethylphenyl)methoxy]benzoic acid (PubChem CID 107014119) has the molecular formula C17H17FO3 and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-fluoro-6-[(2,4,6-trimethylphenyl)methoxy]benzoic acid.
| Compound Name | 2-fluoro-6-[(2,4,6-trimethylphenyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 107014119 |
| Molecular Formula | C17H17FO3 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-fluoro-6-[(2,4,6-trimethylphenyl)methoxy]benzoic acid |
| SMILES | Cc1cc(C)c(COc2cccc(F)c2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H17FO3/c1-10-7-11(2)13(12(3)8-10)9-21-15-6-4-5-14(18)16(15)17(19)20/h4-8H,9H2,1-3H3,(H,19,20) |
| InChIKey | XXRSNBVGUKAJOV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |