4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid

C14H10F2O3 — CID 107014381

IUPAC4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid
SMILESO=C(O)c1ccc(F)cc1OCc1cccc(F)c1
InChIInChI=1S/C14H10F2O3/c15-10-3-1-2-9(6-10)8-19-13-7-11(16)4-5-12(13)14(17)18/h1-7H,8H2,(H,17,18)
InChIKeyGXZYPXGLGVTENA-UHFFFAOYSA-N
MW264.23 g/mol
LogP3.24
Rot. Bonds4

About 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid

4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid (PubChem CID 107014381) has the molecular formula C14H10F2O3 and a molecular weight of 264.23 g/mol. Its IUPAC name is 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid.

Molecular Properties

Compound Name4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid
PubChem CID107014381
Molecular FormulaC14H10F2O3
Molecular Weight264.23 g/mol
Exact Mass264.06
IUPAC Name4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid
SMILESO=C(O)c1ccc(F)cc1OCc1cccc(F)c1
InChIInChI=1S/C14H10F2O3/c15-10-3-1-2-9(6-10)8-19-13-7-11(16)4-5-12(13)14(17)18/h1-7H,8H2,(H,17,18)
InChIKeyGXZYPXGLGVTENA-UHFFFAOYSA-N
XLogP3.24
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.23
LogP ≤ 53.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-amino-2-[(3-fluorophenyl)methoxy]benzoic acid
CID 106954877
2-[(3-fluorophenyl)methoxy]-5-methylbenzoic acid
CID 60652984
2-[(3-bromo-4-fluorophenyl)methoxy]-4-fluorobenzoic acid
CID 107014211
2-[[3-[(2-carboxyphenoxy)methyl]phenyl]methoxy]benzoic acid
CID 71356398
4-fluoro-2-(3-phenylpropoxy)benzoic acid
CID 107014329
1-[5-fluoro-2-[(3-fluorophenyl)methoxy]phenyl]ethanone
CID 78906404
4-fluoro-2-[(4-propan-2-ylphenyl)methoxy]benzoic acid
CID 107014367
5-fluoro-2-[(3-methylphenyl)methoxy]benzoic acid
CID 115298089
2-[(4-cyanophenyl)methoxy]-4-fluorobenzoic acid
CID 107014369
4-fluoro-2-(fluoromethoxy)benzoic acid
CID 175294892
2-[(2-bromo-3-fluorophenyl)methoxy]-4-fluorobenzoic acid
CID 107014584
2-[(3-fluorophenyl)methoxy]-4-methoxybenzamide
CID 17495497

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid?
The IUPAC name of 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid (CID 107014381) is 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid.
What is the SMILES notation for 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid?
The canonical SMILES for 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid is O=C(O)c1ccc(F)cc1OCc1cccc(F)c1.
What is the InChIKey of 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid?
The InChIKey is GXZYPXGLGVTENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2O3/c15-10-3-1-2-9(6-10)8-19-13-7-11(16)4-5-12(13)14(17)18/h1-7H,8H2,(H,17,18).
What are the key properties of 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid?
4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid has a molecular weight of 264.23 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-[(3-fluorophenyl)methoxy]benzoic acid is sourced from PubChem (CID 107014381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).