C13H11FN2O4S — CID 107014550
2-[(2-acetamido-1,3-thiazol-4-yl)methoxy]-4-fluorobenzoic acid (PubChem CID 107014550) has the molecular formula C13H11FN2O4S and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-[(2-acetamido-1,3-thiazol-4-yl)methoxy]-4-fluorobenzoic acid.
| Compound Name | 2-[(2-acetamido-1,3-thiazol-4-yl)methoxy]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 107014550 |
| Molecular Formula | C13H11FN2O4S |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[(2-acetamido-1,3-thiazol-4-yl)methoxy]-4-fluorobenzoic acid |
| SMILES | CC(=O)Nc1nc(COc2cc(F)ccc2C(=O)O)cs1 |
| InChI | InChI=1S/C13H11FN2O4S/c1-7(17)15-13-16-9(6-21-13)5-20-11-4-8(14)2-3-10(11)12(18)19/h2-4,6H,5H2,1H3,(H,18,19)(H,15,16,17) |
| InChIKey | PZKXKTOPIFWIFS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |