C13H17FN2O2 — CID 107014738
2-fluoro-6-hydroxy-N-(4-methylpiperidin-3-yl)benzamide (PubChem CID 107014738) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-fluoro-6-hydroxy-N-(4-methylpiperidin-3-yl)benzamide.
| Compound Name | 2-fluoro-6-hydroxy-N-(4-methylpiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 107014738 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-fluoro-6-hydroxy-N-(4-methylpiperidin-3-yl)benzamide |
| SMILES | CC1CCNCC1NC(=O)c1c(O)cccc1F |
| InChI | InChI=1S/C13H17FN2O2/c1-8-5-6-15-7-10(8)16-13(18)12-9(14)3-2-4-11(12)17/h2-4,8,10,15,17H,5-7H2,1H3,(H,16,18) |
| InChIKey | GYSAIHYDHSWISK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |