C12H12N4O — CID 107017493
1-[(3-ethylimidazol-4-yl)methyl]-2-oxopyridine-3-carbonitrile (PubChem CID 107017493) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-[(3-ethylimidazol-4-yl)methyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[(3-ethylimidazol-4-yl)methyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 107017493 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-[(3-ethylimidazol-4-yl)methyl]-2-oxopyridine-3-carbonitrile |
| SMILES | CCn1cncc1Cn1cccc(C#N)c1=O |
| InChI | InChI=1S/C12H12N4O/c1-2-15-9-14-7-11(15)8-16-5-3-4-10(6-13)12(16)17/h3-5,7,9H,2,8H2,1H3 |
| InChIKey | BTMZCJJVJXOJMC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |