C10H11F3N2OS — CID 107017756
2-oxo-1-(4,4,4-trifluorobutyl)pyridine-3-carbothioamide (PubChem CID 107017756) has the molecular formula C10H11F3N2OS and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-oxo-1-(4,4,4-trifluorobutyl)pyridine-3-carbothioamide.
| Compound Name | 2-oxo-1-(4,4,4-trifluorobutyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107017756 |
| Molecular Formula | C10H11F3N2OS |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-oxo-1-(4,4,4-trifluorobutyl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccn(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C10H11F3N2OS/c11-10(12,13)4-2-6-15-5-1-3-7(8(14)17)9(15)16/h1,3,5H,2,4,6H2,(H2,14,17) |
| InChIKey | ISGPPTPLOHBJOZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|