About 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide
2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide (PubChem CID 107017881) has the molecular formula C10H11F3N2O2S
and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide.
Molecular Properties
| Compound Name | 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide |
| PubChem CID | 107017881 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccn(CCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C10H11F3N2O2S/c11-10(12,13)6-17-5-4-15-3-1-2-7(8(14)18)9(15)16/h1-3H,4-6H2,(H2,14,18) |
| InChIKey | AFFANNWNWNWCPP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide?
The IUPAC name of 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide (CID 107017881) is 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide.
What is the SMILES notation for 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide?
The canonical SMILES for 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide is NC(=S)c1cccn(CCOCC(F)(F)F)c1=O.
What is the InChIKey of 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide?
The InChIKey is AFFANNWNWNWCPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O2S/c11-10(12,13)6-17-5-4-15-3-1-2-7(8(14)18)9(15)16/h1-3H,4-6H2,(H2,14,18).
What are the key properties of 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide?
2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide has a molecular weight of 280.27 g/mol, XLogP of 1.06, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carbothioamide is sourced from PubChem (CID 107017881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).