C13H10Cl2N2OS — CID 107017917
1-[(2,6-dichlorophenyl)methyl]-2-oxopyridine-3-carbothioamide (PubChem CID 107017917) has the molecular formula C13H10Cl2N2OS and a molecular weight of 313.21 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-2-oxopyridine-3-carbothioamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-2-oxopyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107017917 |
| Molecular Formula | C13H10Cl2N2OS |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-2-oxopyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccn(Cc2c(Cl)cccc2Cl)c1=O |
| InChI | InChI=1S/C13H10Cl2N2OS/c14-10-4-1-5-11(15)9(10)7-17-6-2-3-8(12(16)19)13(17)18/h1-6H,7H2,(H2,16,19) |
| InChIKey | KTIWZKODAXBHEF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|