About (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate
(3,5-dimethylcyclohexyl) 2-sulfanylbenzoate (PubChem CID 107018891) has the molecular formula C15H20O2S
and a molecular weight of 264.39 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate.
Molecular Properties
| Compound Name | (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate |
| PubChem CID | 107018891 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate |
| SMILES | CC1CC(C)CC(OC(=O)c2ccccc2S)C1 |
| InChI | InChI=1S/C15H20O2S/c1-10-7-11(2)9-12(8-10)17-15(16)13-5-3-4-6-14(13)18/h3-6,10-12,18H,7-9H2,1-2H3 |
| InChIKey | BOEMHBFTBLWJSI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate?
The IUPAC name of (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate (CID 107018891) is (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate.
What is the SMILES notation for (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate?
The canonical SMILES for (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate is CC1CC(C)CC(OC(=O)c2ccccc2S)C1.
What is the InChIKey of (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate?
The InChIKey is BOEMHBFTBLWJSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2S/c1-10-7-11(2)9-12(8-10)17-15(16)13-5-3-4-6-14(13)18/h3-6,10-12,18H,7-9H2,1-2H3.
What are the key properties of (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate?
(3,5-dimethylcyclohexyl) 2-sulfanylbenzoate has a molecular weight of 264.39 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylcyclohexyl) 2-sulfanylbenzoate is sourced from PubChem (CID 107018891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).