About (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate
(3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate (PubChem CID 107018900) has the molecular formula C14H21NO2S2
and a molecular weight of 299.46 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate.
Molecular Properties
| Compound Name | (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate |
| PubChem CID | 107018900 |
| Molecular Formula | C14H21NO2S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)OC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H21NO2S2/c1-8-4-9(2)6-11(5-8)17-13(16)7-12-10(3)15-14(18)19-12/h8-9,11H,4-7H2,1-3H3,(H,15,18) |
| InChIKey | MHTNGYBNWVGXCT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate?
The IUPAC name of (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate (CID 107018900) is (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate.
What is the SMILES notation for (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate?
The canonical SMILES for (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate is Cc1[nH]c(=S)sc1CC(=O)OC1CC(C)CC(C)C1.
What is the InChIKey of (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate?
The InChIKey is MHTNGYBNWVGXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2S2/c1-8-4-9(2)6-11(5-8)17-13(16)7-12-10(3)15-14(18)19-12/h8-9,11H,4-7H2,1-3H3,(H,15,18).
What are the key properties of (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate?
(3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate has a molecular weight of 299.46 g/mol, XLogP of 4.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylcyclohexyl) 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate is sourced from PubChem (CID 107018900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).