About 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol
2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol (PubChem CID 10702062) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol |
| PubChem CID | 10702062 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol |
| SMILES | C=CCC(/C=C/C)OCCO |
| InChI | InChI=1S/C9H16O2/c1-3-5-9(6-4-2)11-8-7-10/h3-4,6,9-10H,1,5,7-8H2,2H3/b6-4+ |
| InChIKey | HNMZRHKYFDGCBX-GQCTYLIASA-N |
| XLogP | 1.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol?
The IUPAC name of 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol (CID 10702062) is 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol.
What is the SMILES notation for 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol?
The canonical SMILES for 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol is C=CCC(/C=C/C)OCCO.
What is the InChIKey of 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol?
The InChIKey is HNMZRHKYFDGCBX-GQCTYLIASA-N. The full InChI is InChI=1S/C9H16O2/c1-3-5-9(6-4-2)11-8-7-10/h3-4,6,9-10H,1,5,7-8H2,2H3/b6-4+.
What are the key properties of 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol?
2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol has a molecular weight of 156.22 g/mol, XLogP of 1.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5E)-hepta-1,5-dien-4-yl]oxyethanol is sourced from PubChem (CID 10702062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).