C10H10O2 — CID 10702135
(1R,4S)-bicyclo[2.2.2]octa-2,5-diene-2,3-dicarbaldehyde (PubChem CID 10702135) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (1R,4S)-bicyclo[2.2.2]octa-2,5-diene-2,3-dicarbaldehyde.
| Compound Name | (1R,4S)-bicyclo[2.2.2]octa-2,5-diene-2,3-dicarbaldehyde |
|---|---|
| PubChem CID | 10702135 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (1R,4S)-bicyclo[2.2.2]octa-2,5-diene-2,3-dicarbaldehyde |
| SMILES | O=CC1=C(C=O)[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C10H10O2/c11-5-9-7-1-2-8(4-3-7)10(9)6-12/h1-2,5-8H,3-4H2/t7-,8+ |
| InChIKey | YWQKONLUTRCJRI-OCAPTIKFSA-N |
| XLogP | 1.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|