About (1-amino-2,3-dihydroinden-1-yl)methanol
(1-amino-2,3-dihydroinden-1-yl)methanol (PubChem CID 10702154) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (1-amino-2,3-dihydroinden-1-yl)methanol.
Molecular Properties
| Compound Name | (1-amino-2,3-dihydroinden-1-yl)methanol |
| PubChem CID | 10702154 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (1-amino-2,3-dihydroinden-1-yl)methanol |
| SMILES | NC1(CO)CCc2ccccc21 |
| InChI | InChI=1S/C10H13NO/c11-10(7-12)6-5-8-3-1-2-4-9(8)10/h1-4,12H,5-7,11H2 |
| InChIKey | SHSCRKXSHFWZSL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-amino-2,3-dihydroinden-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-2,3-dihydroinden-1-yl)methanol?
The IUPAC name of (1-amino-2,3-dihydroinden-1-yl)methanol (CID 10702154) is (1-amino-2,3-dihydroinden-1-yl)methanol.
What is the SMILES notation for (1-amino-2,3-dihydroinden-1-yl)methanol?
The canonical SMILES for (1-amino-2,3-dihydroinden-1-yl)methanol is NC1(CO)CCc2ccccc21.
What is the InChIKey of (1-amino-2,3-dihydroinden-1-yl)methanol?
The InChIKey is SHSCRKXSHFWZSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c11-10(7-12)6-5-8-3-1-2-4-9(8)10/h1-4,12H,5-7,11H2.
What are the key properties of (1-amino-2,3-dihydroinden-1-yl)methanol?
(1-amino-2,3-dihydroinden-1-yl)methanol has a molecular weight of 163.22 g/mol, XLogP of 0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-2,3-dihydroinden-1-yl)methanol is sourced from PubChem (CID 10702154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).