About 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol
2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol (PubChem CID 10702193) has the molecular formula C6H15NO4
and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol |
| PubChem CID | 10702193 |
| Molecular Formula | C6H15NO4 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol |
| SMILES | OCC(CO)NC(CO)CO |
| InChI | InChI=1S/C6H15NO4/c8-1-5(2-9)7-6(3-10)4-11/h5-11H,1-4H2 |
| InChIKey | UDAOBXRAGBHTNS-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol?
The IUPAC name of 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol (CID 10702193) is 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol.
What is the SMILES notation for 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol?
The canonical SMILES for 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol is OCC(CO)NC(CO)CO.
What is the InChIKey of 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol?
The InChIKey is UDAOBXRAGBHTNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO4/c8-1-5(2-9)7-6(3-10)4-11/h5-11H,1-4H2.
What are the key properties of 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol?
2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol has a molecular weight of 165.19 g/mol, XLogP of -2.72, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dihydroxypropan-2-ylamino)propane-1,3-diol is sourced from PubChem (CID 10702193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).