About 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one
3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 10702198) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
Analyze 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (CID 10702198) is 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one is Nc1cnc2n(c1=O)CCCC2.
What is the InChIKey of 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The InChIKey is HLXLOBLRHZHCOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c9-6-5-10-7-3-1-2-4-11(7)8(6)12/h5H,1-4,9H2.
What are the key properties of 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one has a molecular weight of 165.20 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 10702198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).