About 3,3-diethylazepan-2-one
3,3-diethylazepan-2-one (PubChem CID 10702280) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 3,3-diethylazepan-2-one.
Molecular Properties
| Compound Name | 3,3-diethylazepan-2-one |
| PubChem CID | 10702280 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3,3-diethylazepan-2-one |
| SMILES | CCC1(CC)CCCCNC1=O |
| InChI | InChI=1S/C10H19NO/c1-3-10(4-2)7-5-6-8-11-9(10)12/h3-8H2,1-2H3,(H,11,12) |
| InChIKey | UDCWZVZAASLSTP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-diethylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethylazepan-2-one?
The IUPAC name of 3,3-diethylazepan-2-one (CID 10702280) is 3,3-diethylazepan-2-one.
What is the SMILES notation for 3,3-diethylazepan-2-one?
The canonical SMILES for 3,3-diethylazepan-2-one is CCC1(CC)CCCCNC1=O.
What is the InChIKey of 3,3-diethylazepan-2-one?
The InChIKey is UDCWZVZAASLSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-3-10(4-2)7-5-6-8-11-9(10)12/h3-8H2,1-2H3,(H,11,12).
What are the key properties of 3,3-diethylazepan-2-one?
3,3-diethylazepan-2-one has a molecular weight of 169.27 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethylazepan-2-one is sourced from PubChem (CID 10702280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).