C13H17NO3S2 — CID 107023213
1-(1,1-dioxo-1,4-thiazinan-4-yl)-3-phenyl-2-sulfanylpropan-1-one (PubChem CID 107023213) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-4-yl)-3-phenyl-2-sulfanylpropan-1-one.
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-3-phenyl-2-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 107023213 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-3-phenyl-2-sulfanylpropan-1-one |
| SMILES | O=C(C(S)Cc1ccccc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H17NO3S2/c15-13(14-6-8-19(16,17)9-7-14)12(18)10-11-4-2-1-3-5-11/h1-5,12,18H,6-10H2 |
| InChIKey | ZQBQISRZILKXEL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|