About 1,3-diethyl-N,N-dimethylimidazolidin-2-amine
1,3-diethyl-N,N-dimethylimidazolidin-2-amine (PubChem CID 10702323) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is 1,3-diethyl-N,N-dimethylimidazolidin-2-amine.
Molecular Properties
| Compound Name | 1,3-diethyl-N,N-dimethylimidazolidin-2-amine |
| PubChem CID | 10702323 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 1,3-diethyl-N,N-dimethylimidazolidin-2-amine |
| SMILES | CCN1CCN(CC)C1N(C)C |
| InChI | InChI=1S/C9H21N3/c1-5-11-7-8-12(6-2)9(11)10(3)4/h9H,5-8H2,1-4H3 |
| InChIKey | CGVXFINWTGVAAR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-diethyl-N,N-dimethylimidazolidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-N,N-dimethylimidazolidin-2-amine?
The IUPAC name of 1,3-diethyl-N,N-dimethylimidazolidin-2-amine (CID 10702323) is 1,3-diethyl-N,N-dimethylimidazolidin-2-amine.
What is the SMILES notation for 1,3-diethyl-N,N-dimethylimidazolidin-2-amine?
The canonical SMILES for 1,3-diethyl-N,N-dimethylimidazolidin-2-amine is CCN1CCN(CC)C1N(C)C.
What is the InChIKey of 1,3-diethyl-N,N-dimethylimidazolidin-2-amine?
The InChIKey is CGVXFINWTGVAAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c1-5-11-7-8-12(6-2)9(11)10(3)4/h9H,5-8H2,1-4H3.
What are the key properties of 1,3-diethyl-N,N-dimethylimidazolidin-2-amine?
1,3-diethyl-N,N-dimethylimidazolidin-2-amine has a molecular weight of 171.29 g/mol, XLogP of 0.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-N,N-dimethylimidazolidin-2-amine is sourced from PubChem (CID 10702323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).