C8H14F3NOS — CID 107023494
N,3-dimethyl-2-sulfanyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 107023494) has the molecular formula C8H14F3NOS and a molecular weight of 229.27 g/mol. Its IUPAC name is N,3-dimethyl-2-sulfanyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | N,3-dimethyl-2-sulfanyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 107023494 |
| Molecular Formula | C8H14F3NOS |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N,3-dimethyl-2-sulfanyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CC(C)C(S)C(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C8H14F3NOS/c1-5(2)6(14)7(13)12(3)4-8(9,10)11/h5-6,14H,4H2,1-3H3 |
| InChIKey | JKQOTBDQVFGLAP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|