C15H23N3OS — CID 107024029
N-(3-piperazin-1-ylpropyl)-2-(4-sulfanylphenyl)acetamide (PubChem CID 107024029) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N-(3-piperazin-1-ylpropyl)-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 107024029 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-2-(4-sulfanylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(S)cc1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C15H23N3OS/c19-15(12-13-2-4-14(20)5-3-13)17-6-1-9-18-10-7-16-8-11-18/h2-5,16,20H,1,6-12H2,(H,17,19) |
| InChIKey | VQPRXEKZSROIIA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|