About 2-benzyl-5,6-dihydro-4H-1,3-oxazine
2-benzyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 10702404) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-benzyl-5,6-dihydro-4H-1,3-oxazine.
Molecular Properties
| Compound Name | 2-benzyl-5,6-dihydro-4H-1,3-oxazine |
| PubChem CID | 10702404 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-benzyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | c1ccc(CC2=NCCCO2)cc1 |
| InChI | InChI=1S/C11H13NO/c1-2-5-10(6-3-1)9-11-12-7-4-8-13-11/h1-3,5-6H,4,7-9H2 |
| InChIKey | LGZCCBKPENNNCJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-5,6-dihydro-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5,6-dihydro-4H-1,3-oxazine?
The IUPAC name of 2-benzyl-5,6-dihydro-4H-1,3-oxazine (CID 10702404) is 2-benzyl-5,6-dihydro-4H-1,3-oxazine.
What is the SMILES notation for 2-benzyl-5,6-dihydro-4H-1,3-oxazine?
The canonical SMILES for 2-benzyl-5,6-dihydro-4H-1,3-oxazine is c1ccc(CC2=NCCCO2)cc1.
What is the InChIKey of 2-benzyl-5,6-dihydro-4H-1,3-oxazine?
The InChIKey is LGZCCBKPENNNCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-2-5-10(6-3-1)9-11-12-7-4-8-13-11/h1-3,5-6H,4,7-9H2.
What are the key properties of 2-benzyl-5,6-dihydro-4H-1,3-oxazine?
2-benzyl-5,6-dihydro-4H-1,3-oxazine has a molecular weight of 175.23 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5,6-dihydro-4H-1,3-oxazine is sourced from PubChem (CID 10702404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).