C21H27N3O2 — CID 1070243
3-N,3-N,5-N,5-N-tetraethyl-4-phenylpyridine-3,5-dicarboxamide (PubChem CID 1070243) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-N,3-N,5-N,5-N-tetraethyl-4-phenylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N,3-N,5-N,5-N-tetraethyl-4-phenylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 1070243 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 3-N,3-N,5-N,5-N-tetraethyl-4-phenylpyridine-3,5-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cncc(C(=O)N(CC)CC)c1-c1ccccc1 |
| InChI | InChI=1S/C21H27N3O2/c1-5-23(6-2)20(25)17-14-22-15-18(21(26)24(7-3)8-4)19(17)16-12-10-9-11-13-16/h9-15H,5-8H2,1-4H3 |
| InChIKey | OXSDAOLJSPHDKO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |