About 2-piperidin-4-ylphenol
2-piperidin-4-ylphenol (PubChem CID 10702452) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-piperidin-4-ylphenol.
Molecular Properties
| Compound Name | 2-piperidin-4-ylphenol |
| PubChem CID | 10702452 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-piperidin-4-ylphenol |
| SMILES | Oc1ccccc1C1CCNCC1 |
| InChI | InChI=1S/C11H15NO/c13-11-4-2-1-3-10(11)9-5-7-12-8-6-9/h1-4,9,12-13H,5-8H2 |
| InChIKey | FEKPQWCDELSHHJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-4-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylphenol?
The IUPAC name of 2-piperidin-4-ylphenol (CID 10702452) is 2-piperidin-4-ylphenol.
What is the SMILES notation for 2-piperidin-4-ylphenol?
The canonical SMILES for 2-piperidin-4-ylphenol is Oc1ccccc1C1CCNCC1.
What is the InChIKey of 2-piperidin-4-ylphenol?
The InChIKey is FEKPQWCDELSHHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c13-11-4-2-1-3-10(11)9-5-7-12-8-6-9/h1-4,9,12-13H,5-8H2.
What are the key properties of 2-piperidin-4-ylphenol?
2-piperidin-4-ylphenol has a molecular weight of 177.25 g/mol, XLogP of 1.86, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylphenol is sourced from PubChem (CID 10702452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).