C7H12N6 — CID 10702521
2-N-methyl-5,6,7,8-tetrahydropteridine-2,4-diamine (PubChem CID 10702521) has the molecular formula C7H12N6 and a molecular weight of 180.22 g/mol. Its IUPAC name is 2-N-methyl-5,6,7,8-tetrahydropteridine-2,4-diamine.
| Compound Name | 2-N-methyl-5,6,7,8-tetrahydropteridine-2,4-diamine |
|---|---|
| PubChem CID | 10702521 |
| Molecular Formula | C7H12N6 |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 2-N-methyl-5,6,7,8-tetrahydropteridine-2,4-diamine |
| SMILES | CNc1nc(N)c2c(n1)NCCN2 |
| InChI | InChI=1S/C7H12N6/c1-9-7-12-5(8)4-6(13-7)11-3-2-10-4/h10H,2-3H2,1H3,(H4,8,9,11,12,13) |
| InChIKey | MPJGSEOZOYGCFC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |